C13H22N2 — CID 116948064
1-N-methyl-1-(2,4,6-trimethylphenyl)propane-1,2-diamine (PubChem CID 116948064) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is 1-N-methyl-1-(2,4,6-trimethylphenyl)propane-1,2-diamine.
| Compound Name | 1-N-methyl-1-(2,4,6-trimethylphenyl)propane-1,2-diamine |
|---|---|
| PubChem CID | 116948064 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | 1-N-methyl-1-(2,4,6-trimethylphenyl)propane-1,2-diamine |
| SMILES | CNC(c1c(C)cc(C)cc1C)C(C)N |
| InChI | InChI=1S/C13H22N2/c1-8-6-9(2)12(10(3)7-8)13(15-5)11(4)14/h6-7,11,13,15H,14H2,1-5H3 |
| InChIKey | AOOVWTFASKSWGC-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |