C10H8Br2 — CID 11694985
1,2-bis(1-bromo-2,2-dideuterioethenyl)benzene (PubChem CID 11694985) has the molecular formula C10H8Br2 and a molecular weight of 292.01 g/mol. Its IUPAC name is 1,2-bis(1-bromo-2,2-dideuterioethenyl)benzene.
| Compound Name | 1,2-bis(1-bromo-2,2-dideuterioethenyl)benzene |
|---|---|
| PubChem CID | 11694985 |
| Molecular Formula | C10H8Br2 |
| Molecular Weight | 292.01 g/mol |
| Exact Mass | 289.92 |
| IUPAC Name | 1,2-bis(1-bromo-2,2-dideuterioethenyl)benzene |
| SMILES | [2H]C([2H])=C(Br)c1ccccc1C(Br)=C([2H])[2H] |
| InChI | InChI=1S/C10H8Br2/c1-7(11)9-5-3-4-6-10(9)8(2)12/h3-6H,1-2H2/i1D2,2D2 |
| InChIKey | HNRJMPKFHPWSFS-LNLMKGTHSA-N |
| XLogP | 4.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.01 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |