C11H15BrN2 — CID 116950844
1-(azetidin-3-yl)-1-(2-bromophenyl)-N-methylmethanamine (PubChem CID 116950844) has the molecular formula C11H15BrN2 and a molecular weight of 255.16 g/mol. Its IUPAC name is 1-(azetidin-3-yl)-1-(2-bromophenyl)-N-methylmethanamine.
| Compound Name | 1-(azetidin-3-yl)-1-(2-bromophenyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 116950844 |
| Molecular Formula | C11H15BrN2 |
| Molecular Weight | 255.16 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | 1-(azetidin-3-yl)-1-(2-bromophenyl)-N-methylmethanamine |
| SMILES | CNC(c1ccccc1Br)C1CNC1 |
| InChI | InChI=1S/C11H15BrN2/c1-13-11(8-6-14-7-8)9-4-2-3-5-10(9)12/h2-5,8,11,13-14H,6-7H2,1H3 |
| InChIKey | IVGSLHDPPPUNBP-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.16 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |