C17H27ClN4O2 — CID 11696096
(2R,5S)-1-[2-[[1-(propoxymethyl)cyclopentyl]amino]acetyl]pyrrolidine-2,5-dicarbonitrile;hydrochloride (PubChem CID 11696096) has the molecular formula C17H27ClN4O2 and a molecular weight of 354.88 g/mol. Its IUPAC name is (2R,5S)-1-[2-[[1-(propoxymethyl)cyclopentyl]amino]acetyl]pyrrolidine-2,5-dicarbonitrile;hydrochloride.
| Compound Name | (2R,5S)-1-[2-[[1-(propoxymethyl)cyclopentyl]amino]acetyl]pyrrolidine-2,5-dicarbonitrile;hydrochloride |
|---|---|
| PubChem CID | 11696096 |
| Molecular Formula | C17H27ClN4O2 |
| Molecular Weight | 354.88 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | (2R,5S)-1-[2-[[1-(propoxymethyl)cyclopentyl]amino]acetyl]pyrrolidine-2,5-dicarbonitrile;hydrochloride |
| SMILES | CCCOCC1(NCC(=O)N2[C@H](C#N)CC[C@@H]2C#N)CCCC1.Cl |
| InChI | InChI=1S/C17H26N4O2.ClH/c1-2-9-23-13-17(7-3-4-8-17)20-12-16(22)21-14(10-18)5-6-15(21)11-19;/h14-15,20H,2-9,12-13H2,1H3;1H/t14-,15+; |
| InChIKey | BCMSMCKNEPNYIQ-KBGJBQQCSA-N |
| XLogP | 2.14 |
| TPSA | 89.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.88 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|