C22H24F3N3O2 — CID 87136707
(2S,5R)-5-ethynyl-1-[2-[[1-[3-(trifluoromethyl)phenoxy]cyclohexyl]amino]acetyl]pyrrolidine-2-carbonitrile (PubChem CID 87136707) has the molecular formula C22H24F3N3O2 and a molecular weight of 419.45 g/mol. Its IUPAC name is (2S,5R)-5-ethynyl-1-[2-[[1-[3-(trifluoromethyl)phenoxy]cyclohexyl]amino]acetyl]pyrrolidine-2-carbonitrile.
| Compound Name | (2S,5R)-5-ethynyl-1-[2-[[1-[3-(trifluoromethyl)phenoxy]cyclohexyl]amino]acetyl]pyrrolidine-2-carbonitrile |
|---|---|
| PubChem CID | 87136707 |
| Molecular Formula | C22H24F3N3O2 |
| Molecular Weight | 419.45 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | (2S,5R)-5-ethynyl-1-[2-[[1-[3-(trifluoromethyl)phenoxy]cyclohexyl]amino]acetyl]pyrrolidine-2-carbonitrile |
| SMILES | C#C[C@H]1CC[C@@H](C#N)N1C(=O)CNC1(Oc2cccc(C(F)(F)F)c2)CCCCC1 |
| InChI | InChI=1S/C22H24F3N3O2/c1-2-17-9-10-18(14-26)28(17)20(29)15-27-21(11-4-3-5-12-21)30-19-8-6-7-16(13-19)22(23,24)25/h1,6-8,13,17-18,27H,3-5,9-12,15H2/t17-,18-/m0/s1 |
| InChIKey | ZGOVRMBJXUERFV-ROUUACIJSA-N |
| XLogP | 3.85 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.45 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|