C19H31NO4S — CID 11696360
tert-butyl N-[1-(4-methylphenyl)sulfonylheptyl]carbamate (PubChem CID 11696360) has the molecular formula C19H31NO4S and a molecular weight of 369.53 g/mol. Its IUPAC name is tert-butyl N-[1-(4-methylphenyl)sulfonylheptyl]carbamate.
| Compound Name | tert-butyl N-[1-(4-methylphenyl)sulfonylheptyl]carbamate |
|---|---|
| PubChem CID | 11696360 |
| Molecular Formula | C19H31NO4S |
| Molecular Weight | 369.53 g/mol |
| Exact Mass | 369.20 |
| IUPAC Name | tert-butyl N-[1-(4-methylphenyl)sulfonylheptyl]carbamate |
| SMILES | CCCCCCC(NC(=O)OC(C)(C)C)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H31NO4S/c1-6-7-8-9-10-17(20-18(21)24-19(3,4)5)25(22,23)16-13-11-15(2)12-14-16/h11-14,17H,6-10H2,1-5H3,(H,20,21) |
| InChIKey | ZAVRWPTYFNBPJY-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.53 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|