C13H19NO2S — CID 116968718
4-(4-cyclobutyl-1,3-thiazol-2-yl)-3,3-dimethylbutanoic acid (PubChem CID 116968718) has the molecular formula C13H19NO2S and a molecular weight of 253.37 g/mol. Its IUPAC name is 4-(4-cyclobutyl-1,3-thiazol-2-yl)-3,3-dimethylbutanoic acid.
| Compound Name | 4-(4-cyclobutyl-1,3-thiazol-2-yl)-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 116968718 |
| Molecular Formula | C13H19NO2S |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 4-(4-cyclobutyl-1,3-thiazol-2-yl)-3,3-dimethylbutanoic acid |
| SMILES | CC(C)(CC(=O)O)Cc1nc(C2CCC2)cs1 |
| InChI | InChI=1S/C13H19NO2S/c1-13(2,7-12(15)16)6-11-14-10(8-17-11)9-4-3-5-9/h8-9H,3-7H2,1-2H3,(H,15,16) |
| InChIKey | PGLQQTKQOKUJJB-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |