C25H32O3S — CID 11697277
3-[4-(3-hydroxypropoxy)-3,5-dimethylphenyl]-1-[(2S,4R)-3,3,9-trimethyl-8-thiatricyclo[4.3.0.02,4]nona-1(9),6-dien-7-yl]propan-1-one (PubChem CID 11697277) has the molecular formula C25H32O3S and a molecular weight of 412.60 g/mol. Its IUPAC name is 3-[4-(3-hydroxypropoxy)-3,5-dimethylphenyl]-1-[(2S,4R)-3,3,9-trimethyl-8-thiatricyclo[4.3.0.02,4]nona-1(9),6-dien-7-yl]propan-1-one.
| Compound Name | 3-[4-(3-hydroxypropoxy)-3,5-dimethylphenyl]-1-[(2S,4R)-3,3,9-trimethyl-8-thiatricyclo[4.3.0.02,4]nona-1(9),6-dien-7-yl]propan-1-one |
|---|---|
| PubChem CID | 11697277 |
| Molecular Formula | C25H32O3S |
| Molecular Weight | 412.60 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | 3-[4-(3-hydroxypropoxy)-3,5-dimethylphenyl]-1-[(2S,4R)-3,3,9-trimethyl-8-thiatricyclo[4.3.0.02,4]nona-1(9),6-dien-7-yl]propan-1-one |
| SMILES | Cc1cc(CCC(=O)c2sc(C)c3c2C[C@@H]2[C@H]3C2(C)C)cc(C)c1OCCCO |
| InChI | InChI=1S/C25H32O3S/c1-14-11-17(12-15(2)23(14)28-10-6-9-26)7-8-20(27)24-18-13-19-22(25(19,4)5)21(18)16(3)29-24/h11-12,19,22,26H,6-10,13H2,1-5H3/t19-,22-/m1/s1 |
| InChIKey | ZERTUXJRUFAAPZ-DENIHFKCSA-N |
| XLogP | 5.55 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.60 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|