C11H13BrN4S — CID 116974203
N'-[5-(4-bromothiophen-2-yl)pyrimidin-2-yl]-N-methylethane-1,2-diamine (PubChem CID 116974203) has the molecular formula C11H13BrN4S and a molecular weight of 313.22 g/mol. Its IUPAC name is N'-[5-(4-bromothiophen-2-yl)pyrimidin-2-yl]-N-methylethane-1,2-diamine.
| Compound Name | N'-[5-(4-bromothiophen-2-yl)pyrimidin-2-yl]-N-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 116974203 |
| Molecular Formula | C11H13BrN4S |
| Molecular Weight | 313.22 g/mol |
| Exact Mass | 312.00 |
| IUPAC Name | N'-[5-(4-bromothiophen-2-yl)pyrimidin-2-yl]-N-methylethane-1,2-diamine |
| SMILES | CNCCNc1ncc(-c2cc(Br)cs2)cn1 |
| InChI | InChI=1S/C11H13BrN4S/c1-13-2-3-14-11-15-5-8(6-16-11)10-4-9(12)7-17-10/h4-7,13H,2-3H2,1H3,(H,14,15,16) |
| InChIKey | BEWKPMACMUXPCH-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.22 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|