C13H16N2O — CID 116980815
4-(2,3-dihydro-1H-inden-5-yl)-1-methylimidazolidin-2-one (PubChem CID 116980815) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is 4-(2,3-dihydro-1H-inden-5-yl)-1-methylimidazolidin-2-one.
| Compound Name | 4-(2,3-dihydro-1H-inden-5-yl)-1-methylimidazolidin-2-one |
|---|---|
| PubChem CID | 116980815 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 4-(2,3-dihydro-1H-inden-5-yl)-1-methylimidazolidin-2-one |
| SMILES | CN1CC(c2ccc3c(c2)CCC3)NC1=O |
| InChI | InChI=1S/C13H16N2O/c1-15-8-12(14-13(15)16)11-6-5-9-3-2-4-10(9)7-11/h5-7,12H,2-4,8H2,1H3,(H,14,16) |
| InChIKey | XNDIPSLAXLKLLV-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |