C27H37F2N3O2 — CID 11698546
N-[(2S,3R)-3-amino-1-(3,5-difluorophenyl)-4-[[(4S)-6-(2,2-dimethylpropyl)-4-methyl-2,3-dihydrochromen-4-yl]amino]butan-2-yl]acetamide (PubChem CID 11698546) has the molecular formula C27H37F2N3O2 and a molecular weight of 473.61 g/mol. Its IUPAC name is N-[(2S,3R)-3-amino-1-(3,5-difluorophenyl)-4-[[(4S)-6-(2,2-dimethylpropyl)-4-methyl-2,3-dihydrochromen-4-yl]amino]butan-2-yl]acetamide.
| Compound Name | N-[(2S,3R)-3-amino-1-(3,5-difluorophenyl)-4-[[(4S)-6-(2,2-dimethylpropyl)-4-methyl-2,3-dihydrochromen-4-yl]amino]butan-2-yl]acetamide |
|---|---|
| PubChem CID | 11698546 |
| Molecular Formula | C27H37F2N3O2 |
| Molecular Weight | 473.61 g/mol |
| Exact Mass | 473.29 |
| IUPAC Name | N-[(2S,3R)-3-amino-1-(3,5-difluorophenyl)-4-[[(4S)-6-(2,2-dimethylpropyl)-4-methyl-2,3-dihydrochromen-4-yl]amino]butan-2-yl]acetamide |
| SMILES | CC(=O)N[C@@H](Cc1cc(F)cc(F)c1)[C@H](N)CN[C@@]1(C)CCOc2ccc(CC(C)(C)C)cc21 |
| InChI | InChI=1S/C27H37F2N3O2/c1-17(33)32-24(13-19-10-20(28)14-21(29)11-19)23(30)16-31-27(5)8-9-34-25-7-6-18(12-22(25)27)15-26(2,3)4/h6-7,10-12,14,23-24,31H,8-9,13,15-16,30H2,1-5H3,(H,32,33)/t23-,24+,27+/m1/s1 |
| InChIKey | PQQCKKPTUAMODD-DXBVXKBHSA-N |
| XLogP | 4.22 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.61 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |