1-(thiatriazol-5-yl)cyclobutane-1-carboxylic acid

C6H7N3O2S — CID 116985776

IUPAC1-(thiatriazol-5-yl)cyclobutane-1-carboxylic acid
SMILESO=C(O)C1(c2nnns2)CCC1
InChIInChI=1S/C6H7N3O2S/c10-5(11)6(2-1-3-6)4-7-8-9-12-4/h1-3H2,(H,10,11)
InChIKeyROQSWYKCZHLQIM-UHFFFAOYSA-N
MW185.21 g/mol
LogP0.44
Rot. Bonds2

About 1-(thiatriazol-5-yl)cyclobutane-1-carboxylic acid

1-(thiatriazol-5-yl)cyclobutane-1-carboxylic acid (PubChem CID 116985776) has the molecular formula C6H7N3O2S and a molecular weight of 185.21 g/mol. Its IUPAC name is 1-(thiatriazol-5-yl)cyclobutane-1-carboxylic acid.

Molecular Properties

Compound Name1-(thiatriazol-5-yl)cyclobutane-1-carboxylic acid
PubChem CID116985776
Molecular FormulaC6H7N3O2S
Molecular Weight185.21 g/mol
Exact Mass185.03
IUPAC Name1-(thiatriazol-5-yl)cyclobutane-1-carboxylic acid
SMILESO=C(O)C1(c2nnns2)CCC1
InChIInChI=1S/C6H7N3O2S/c10-5(11)6(2-1-3-6)4-7-8-9-12-4/h1-3H2,(H,10,11)
InChIKeyROQSWYKCZHLQIM-UHFFFAOYSA-N
XLogP0.44
TPSA75.97 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500185.21
LogP ≤ 50.44
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 1-(thiatriazol-5-yl)cyclobutane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(thiatriazol-5-yl)cyclobutane-1-carboxylic acid?
The IUPAC name of 1-(thiatriazol-5-yl)cyclobutane-1-carboxylic acid (CID 116985776) is 1-(thiatriazol-5-yl)cyclobutane-1-carboxylic acid.
What is the SMILES notation for 1-(thiatriazol-5-yl)cyclobutane-1-carboxylic acid?
The canonical SMILES for 1-(thiatriazol-5-yl)cyclobutane-1-carboxylic acid is O=C(O)C1(c2nnns2)CCC1.
What is the InChIKey of 1-(thiatriazol-5-yl)cyclobutane-1-carboxylic acid?
The InChIKey is ROQSWYKCZHLQIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N3O2S/c10-5(11)6(2-1-3-6)4-7-8-9-12-4/h1-3H2,(H,10,11).
What are the key properties of 1-(thiatriazol-5-yl)cyclobutane-1-carboxylic acid?
1-(thiatriazol-5-yl)cyclobutane-1-carboxylic acid has a molecular weight of 185.21 g/mol, XLogP of 0.44, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(thiatriazol-5-yl)cyclobutane-1-carboxylic acid is sourced from PubChem (CID 116985776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).