C14H17NO4 — CID 116986778
5-(methylamino)-2,3,4,7,8,9-hexahydropyrano[2,3-g]chromene-10-carboxylic acid (PubChem CID 116986778) has the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. Its IUPAC name is 5-(methylamino)-2,3,4,7,8,9-hexahydropyrano[2,3-g]chromene-10-carboxylic acid.
| Compound Name | 5-(methylamino)-2,3,4,7,8,9-hexahydropyrano[2,3-g]chromene-10-carboxylic acid |
|---|---|
| PubChem CID | 116986778 |
| Molecular Formula | C14H17NO4 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | 5-(methylamino)-2,3,4,7,8,9-hexahydropyrano[2,3-g]chromene-10-carboxylic acid |
| SMILES | CNc1c2c(c(C(=O)O)c3c1OCCC3)OCCC2 |
| InChI | InChI=1S/C14H17NO4/c1-15-11-9-5-3-6-18-12(9)10(14(16)17)8-4-2-7-19-13(8)11/h15H,2-7H2,1H3,(H,16,17) |
| InChIKey | AVRRVVMXFDZDAS-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |