C14H14N2O3 — CID 116986798
10-cyano-2,3,4,7,8,9-hexahydropyrano[2,3-g]chromene-5-carboxamide (PubChem CID 116986798) has the molecular formula C14H14N2O3 and a molecular weight of 258.28 g/mol. Its IUPAC name is 10-cyano-2,3,4,7,8,9-hexahydropyrano[2,3-g]chromene-5-carboxamide.
| Compound Name | 10-cyano-2,3,4,7,8,9-hexahydropyrano[2,3-g]chromene-5-carboxamide |
|---|---|
| PubChem CID | 116986798 |
| Molecular Formula | C14H14N2O3 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 10-cyano-2,3,4,7,8,9-hexahydropyrano[2,3-g]chromene-5-carboxamide |
| SMILES | N#Cc1c2c(c(C(N)=O)c3c1OCCC3)OCCC2 |
| InChI | InChI=1S/C14H14N2O3/c15-7-10-8-3-1-6-19-13(8)11(14(16)17)9-4-2-5-18-12(9)10/h1-6H2,(H2,16,17) |
| InChIKey | DIHKPYLHMPHKCC-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 85.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |