C5H9NO3 — CID 116986869
2,6,7-trioxabicyclo[2.2.2]octan-1-amine (PubChem CID 116986869) has the molecular formula C5H9NO3 and a molecular weight of 131.13 g/mol. Its IUPAC name is 2,6,7-trioxabicyclo[2.2.2]octan-1-amine.
| Compound Name | 2,6,7-trioxabicyclo[2.2.2]octan-1-amine |
|---|---|
| PubChem CID | 116986869 |
| Molecular Formula | C5H9NO3 |
| Molecular Weight | 131.13 g/mol |
| Exact Mass | 131.06 |
| IUPAC Name | 2,6,7-trioxabicyclo[2.2.2]octan-1-amine |
| SMILES | NC12OCC(CO1)CO2 |
| InChI | InChI=1S/C5H9NO3/c6-5-7-1-4(2-8-5)3-9-5/h4H,1-3,6H2 |
| InChIKey | JJMWDADKZXWJNW-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.13 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |