About 6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-3a-amine
6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-3a-amine (PubChem CID 141171983) has the molecular formula C5H9NO3
and a molecular weight of 131.13 g/mol. Its IUPAC name is 6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-3a-amine.
Analyze 6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-3a-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-3a-amine?
The IUPAC name of 6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-3a-amine (CID 141171983) is 6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-3a-amine.
What is the SMILES notation for 6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-3a-amine?
The canonical SMILES for 6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-3a-amine is NC12COCC1OCO2.
What is the InChIKey of 6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-3a-amine?
The InChIKey is NUFNWXAVBVETJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO3/c6-5-2-7-1-4(5)8-3-9-5/h4H,1-3,6H2.
What are the key properties of 6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-3a-amine?
6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-3a-amine has a molecular weight of 131.13 g/mol, XLogP of -0.96, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-3a-amine is sourced from PubChem (CID 141171983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).