C28H34ClFN2O2 — CID 11698750
N-ethyl-N-[(2-fluorophenyl)methyl]-6-(3-piperidin-1-ylpropoxy)naphthalene-2-carboxamide;hydrochloride (PubChem CID 11698750) has the molecular formula C28H34ClFN2O2 and a molecular weight of 485.04 g/mol. Its IUPAC name is N-ethyl-N-[(2-fluorophenyl)methyl]-6-(3-piperidin-1-ylpropoxy)naphthalene-2-carboxamide;hydrochloride.
| Compound Name | N-ethyl-N-[(2-fluorophenyl)methyl]-6-(3-piperidin-1-ylpropoxy)naphthalene-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 11698750 |
| Molecular Formula | C28H34ClFN2O2 |
| Molecular Weight | 485.04 g/mol |
| Exact Mass | 484.23 |
| IUPAC Name | N-ethyl-N-[(2-fluorophenyl)methyl]-6-(3-piperidin-1-ylpropoxy)naphthalene-2-carboxamide;hydrochloride |
| SMILES | CCN(Cc1ccccc1F)C(=O)c1ccc2cc(OCCCN3CCCCC3)ccc2c1.Cl |
| InChI | InChI=1S/C28H33FN2O2.ClH/c1-2-31(21-25-9-4-5-10-27(25)29)28(32)24-12-11-23-20-26(14-13-22(23)19-24)33-18-8-17-30-15-6-3-7-16-30;/h4-5,9-14,19-20H,2-3,6-8,15-18,21H2,1H3;1H |
| InChIKey | NCORSQNSXZRMKE-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.04 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|