C20H19F3N2O5S2 — CID 11698798
1-benzylsulfanyl-2-[1-methylsulfonyl-5-nitro-6-(trifluoromethyl)indol-2-yl]propan-2-ol (PubChem CID 11698798) has the molecular formula C20H19F3N2O5S2 and a molecular weight of 488.51 g/mol. Its IUPAC name is 1-benzylsulfanyl-2-[1-methylsulfonyl-5-nitro-6-(trifluoromethyl)indol-2-yl]propan-2-ol.
| Compound Name | 1-benzylsulfanyl-2-[1-methylsulfonyl-5-nitro-6-(trifluoromethyl)indol-2-yl]propan-2-ol |
|---|---|
| PubChem CID | 11698798 |
| Molecular Formula | C20H19F3N2O5S2 |
| Molecular Weight | 488.51 g/mol |
| Exact Mass | 488.07 |
| IUPAC Name | 1-benzylsulfanyl-2-[1-methylsulfonyl-5-nitro-6-(trifluoromethyl)indol-2-yl]propan-2-ol |
| SMILES | CC(O)(CSCc1ccccc1)c1cc2cc([N+](=O)[O-])c(C(F)(F)F)cc2n1S(C)(=O)=O |
| InChI | InChI=1S/C20H19F3N2O5S2/c1-19(26,12-31-11-13-6-4-3-5-7-13)18-9-14-8-17(25(27)28)15(20(21,22)23)10-16(14)24(18)32(2,29)30/h3-10,26H,11-12H2,1-2H3 |
| InChIKey | KLJGPIZMTUDBEF-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.51 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|