C14H15F3N2O5S — CID 11596030
4-methylsulfonyl-2-[5-nitro-6-(trifluoromethyl)-1H-indol-2-yl]butan-2-ol (PubChem CID 11596030) has the molecular formula C14H15F3N2O5S and a molecular weight of 380.34 g/mol. Its IUPAC name is 4-methylsulfonyl-2-[5-nitro-6-(trifluoromethyl)-1H-indol-2-yl]butan-2-ol.
| Compound Name | 4-methylsulfonyl-2-[5-nitro-6-(trifluoromethyl)-1H-indol-2-yl]butan-2-ol |
|---|---|
| PubChem CID | 11596030 |
| Molecular Formula | C14H15F3N2O5S |
| Molecular Weight | 380.34 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | 4-methylsulfonyl-2-[5-nitro-6-(trifluoromethyl)-1H-indol-2-yl]butan-2-ol |
| SMILES | CC(O)(CCS(C)(=O)=O)c1cc2cc([N+](=O)[O-])c(C(F)(F)F)cc2[nH]1 |
| InChI | InChI=1S/C14H15F3N2O5S/c1-13(20,3-4-25(2,23)24)12-6-8-5-11(19(21)22)9(14(15,16)17)7-10(8)18-12/h5-7,18,20H,3-4H2,1-2H3 |
| InChIKey | ZOWZMTOXMAIJLS-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 113.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.34 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|