C15H17F3N2O3S — CID 123209138
1-ethylsulfanyl-2-[5-nitro-6-(trifluoromethyl)-1H-indol-3-yl]butan-2-ol (PubChem CID 123209138) has the molecular formula C15H17F3N2O3S and a molecular weight of 362.37 g/mol. Its IUPAC name is 1-ethylsulfanyl-2-[5-nitro-6-(trifluoromethyl)-1H-indol-3-yl]butan-2-ol.
| Compound Name | 1-ethylsulfanyl-2-[5-nitro-6-(trifluoromethyl)-1H-indol-3-yl]butan-2-ol |
|---|---|
| PubChem CID | 123209138 |
| Molecular Formula | C15H17F3N2O3S |
| Molecular Weight | 362.37 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | 1-ethylsulfanyl-2-[5-nitro-6-(trifluoromethyl)-1H-indol-3-yl]butan-2-ol |
| SMILES | CCSCC(O)(CC)c1c[nH]c2cc(C(F)(F)F)c([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C15H17F3N2O3S/c1-3-14(21,8-24-4-2)11-7-19-12-6-10(15(16,17)18)13(20(22)23)5-9(11)12/h5-7,19,21H,3-4,8H2,1-2H3 |
| InChIKey | CKXAZBGUNPMJLO-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 79.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.37 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|