C16H17F3N2O3S — CID 174526420
2-hydroxy-2-[5-nitro-6-(trifluoromethyl)-1H-indol-2-yl]heptane-3-thione (PubChem CID 174526420) has the molecular formula C16H17F3N2O3S and a molecular weight of 374.38 g/mol. Its IUPAC name is 2-hydroxy-2-[5-nitro-6-(trifluoromethyl)-1H-indol-2-yl]heptane-3-thione.
| Compound Name | 2-hydroxy-2-[5-nitro-6-(trifluoromethyl)-1H-indol-2-yl]heptane-3-thione |
|---|---|
| PubChem CID | 174526420 |
| Molecular Formula | C16H17F3N2O3S |
| Molecular Weight | 374.38 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | 2-hydroxy-2-[5-nitro-6-(trifluoromethyl)-1H-indol-2-yl]heptane-3-thione |
| SMILES | CCCCC(=S)C(C)(O)c1cc2cc([N+](=O)[O-])c(C(F)(F)F)cc2[nH]1 |
| InChI | InChI=1S/C16H17F3N2O3S/c1-3-4-5-14(25)15(2,22)13-7-9-6-12(21(23)24)10(16(17,18)19)8-11(9)20-13/h6-8,20,22H,3-5H2,1-2H3 |
| InChIKey | FGHOTJSMJIAJIL-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 79.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.38 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|