C15H14F3N2O3S- — CID 174630611
2-[5-cyano-6-(trifluoromethyl)-1H-indol-2-yl]-2-hydroxypentane-3-sulfinate (PubChem CID 174630611) has the molecular formula C15H14F3N2O3S- and a molecular weight of 359.35 g/mol. Its IUPAC name is 2-[5-cyano-6-(trifluoromethyl)-1H-indol-2-yl]-2-hydroxypentane-3-sulfinate.
| Compound Name | 2-[5-cyano-6-(trifluoromethyl)-1H-indol-2-yl]-2-hydroxypentane-3-sulfinate |
|---|---|
| PubChem CID | 174630611 |
| Molecular Formula | C15H14F3N2O3S- |
| Molecular Weight | 359.35 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | 2-[5-cyano-6-(trifluoromethyl)-1H-indol-2-yl]-2-hydroxypentane-3-sulfinate |
| SMILES | CCC(S(=O)[O-])C(C)(O)c1cc2cc(C#N)c(C(F)(F)F)cc2[nH]1 |
| InChI | InChI=1S/C15H15F3N2O3S/c1-3-13(24(22)23)14(2,21)12-5-8-4-9(7-19)10(15(16,17)18)6-11(8)20-12/h4-6,13,20-21H,3H2,1-2H3,(H,22,23)/p-1 |
| InChIKey | DVMFCJQERREHER-UHFFFAOYSA-M |
| XLogP | 2.92 |
| TPSA | 99.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.35 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|