C9H4F3N3S — CID 134459881
2-sulfanylidene-6-(trifluoromethyl)-1,3-dihydrobenzimidazole-5-carbonitrile (PubChem CID 134459881) has the molecular formula C9H4F3N3S and a molecular weight of 243.21 g/mol. Its IUPAC name is 2-sulfanylidene-6-(trifluoromethyl)-1,3-dihydrobenzimidazole-5-carbonitrile.
| Compound Name | 2-sulfanylidene-6-(trifluoromethyl)-1,3-dihydrobenzimidazole-5-carbonitrile |
|---|---|
| PubChem CID | 134459881 |
| Molecular Formula | C9H4F3N3S |
| Molecular Weight | 243.21 g/mol |
| Exact Mass | 243.01 |
| IUPAC Name | 2-sulfanylidene-6-(trifluoromethyl)-1,3-dihydrobenzimidazole-5-carbonitrile |
| SMILES | N#Cc1cc2[nH]c(=S)[nH]c2cc1C(F)(F)F |
| InChI | InChI=1S/C9H4F3N3S/c10-9(11,12)5-2-7-6(1-4(5)3-13)14-8(16)15-7/h1-2H,(H2,14,15,16) |
| InChIKey | FEDBMCGEIUEKNT-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 55.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.21 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|