C19H15F3N2OS — CID 71056990
2-(2-hydroxypropan-2-yl)-3-phenylsulfanyl-6-(trifluoromethyl)-1H-indole-5-carbonitrile (PubChem CID 71056990) has the molecular formula C19H15F3N2OS and a molecular weight of 376.40 g/mol. Its IUPAC name is 2-(2-hydroxypropan-2-yl)-3-phenylsulfanyl-6-(trifluoromethyl)-1H-indole-5-carbonitrile.
| Compound Name | 2-(2-hydroxypropan-2-yl)-3-phenylsulfanyl-6-(trifluoromethyl)-1H-indole-5-carbonitrile |
|---|---|
| PubChem CID | 71056990 |
| Molecular Formula | C19H15F3N2OS |
| Molecular Weight | 376.40 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | 2-(2-hydroxypropan-2-yl)-3-phenylsulfanyl-6-(trifluoromethyl)-1H-indole-5-carbonitrile |
| SMILES | CC(C)(O)c1[nH]c2cc(C(F)(F)F)c(C#N)cc2c1Sc1ccccc1 |
| InChI | InChI=1S/C19H15F3N2OS/c1-18(2,25)17-16(26-12-6-4-3-5-7-12)13-8-11(10-23)14(19(20,21)22)9-15(13)24-17/h3-9,24-25H,1-2H3 |
| InChIKey | IASKUHRKRGOGDI-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.40 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |