C35H38N6O2 — CID 11699808
4-tert-butyl-N-[2-methyl-5-[8-(N-methyl-4-morpholin-4-ylanilino)imidazo[1,2-a]pyrazin-6-yl]phenyl]benzamide (PubChem CID 11699808) has the molecular formula C35H38N6O2 and a molecular weight of 574.73 g/mol. Its IUPAC name is 4-tert-butyl-N-[2-methyl-5-[8-(N-methyl-4-morpholin-4-ylanilino)imidazo[1,2-a]pyrazin-6-yl]phenyl]benzamide.
| Compound Name | 4-tert-butyl-N-[2-methyl-5-[8-(N-methyl-4-morpholin-4-ylanilino)imidazo[1,2-a]pyrazin-6-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 11699808 |
| Molecular Formula | C35H38N6O2 |
| Molecular Weight | 574.73 g/mol |
| Exact Mass | 574.31 |
| IUPAC Name | 4-tert-butyl-N-[2-methyl-5-[8-(N-methyl-4-morpholin-4-ylanilino)imidazo[1,2-a]pyrazin-6-yl]phenyl]benzamide |
| SMILES | Cc1ccc(-c2cn3ccnc3c(N(C)c3ccc(N4CCOCC4)cc3)n2)cc1NC(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C35H38N6O2/c1-24-6-7-26(22-30(24)38-34(42)25-8-10-27(11-9-25)35(2,3)4)31-23-41-17-16-36-32(41)33(37-31)39(5)28-12-14-29(15-13-28)40-18-20-43-21-19-40/h6-17,22-23H,18-21H2,1-5H3,(H,38,42) |
| InChIKey | GWKVEPSPWJYXIM-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 75.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.73 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|