C11H20F2N2O — CID 117007662
4-[2-(3,3-difluoropiperidin-1-yl)ethyl]morpholine (PubChem CID 117007662) has the molecular formula C11H20F2N2O and a molecular weight of 234.29 g/mol. Its IUPAC name is 4-[2-(3,3-difluoropiperidin-1-yl)ethyl]morpholine.
| Compound Name | 4-[2-(3,3-difluoropiperidin-1-yl)ethyl]morpholine |
|---|---|
| PubChem CID | 117007662 |
| Molecular Formula | C11H20F2N2O |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | 4-[2-(3,3-difluoropiperidin-1-yl)ethyl]morpholine |
| SMILES | FC1(F)CCCN(CCN2CCOCC2)C1 |
| InChI | InChI=1S/C11H20F2N2O/c12-11(13)2-1-3-15(10-11)5-4-14-6-8-16-9-7-14/h1-10H2 |
| InChIKey | QTZVYEYHRGRVDG-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |