C9H15NO5 — CID 117010254
3-(3-methoxypropyl)-2-oxo-1,3-oxazinane-5-carboxylic acid (PubChem CID 117010254) has the molecular formula C9H15NO5 and a molecular weight of 217.22 g/mol. Its IUPAC name is 3-(3-methoxypropyl)-2-oxo-1,3-oxazinane-5-carboxylic acid.
| Compound Name | 3-(3-methoxypropyl)-2-oxo-1,3-oxazinane-5-carboxylic acid |
|---|---|
| PubChem CID | 117010254 |
| Molecular Formula | C9H15NO5 |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.10 |
| IUPAC Name | 3-(3-methoxypropyl)-2-oxo-1,3-oxazinane-5-carboxylic acid |
| SMILES | COCCCN1CC(C(=O)O)COC1=O |
| InChI | InChI=1S/C9H15NO5/c1-14-4-2-3-10-5-7(8(11)12)6-15-9(10)13/h7H,2-6H2,1H3,(H,11,12) |
| InChIKey | DBSGCBPSNBMEOY-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|