C12H15FN2O2 — CID 117010932
4-(2-aminoethyl)-3-(2-fluorophenyl)-1,3-oxazinan-2-one (PubChem CID 117010932) has the molecular formula C12H15FN2O2 and a molecular weight of 238.26 g/mol. Its IUPAC name is 4-(2-aminoethyl)-3-(2-fluorophenyl)-1,3-oxazinan-2-one.
| Compound Name | 4-(2-aminoethyl)-3-(2-fluorophenyl)-1,3-oxazinan-2-one |
|---|---|
| PubChem CID | 117010932 |
| Molecular Formula | C12H15FN2O2 |
| Molecular Weight | 238.26 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 4-(2-aminoethyl)-3-(2-fluorophenyl)-1,3-oxazinan-2-one |
| SMILES | NCCC1CCOC(=O)N1c1ccccc1F |
| InChI | InChI=1S/C12H15FN2O2/c13-10-3-1-2-4-11(10)15-9(5-7-14)6-8-17-12(15)16/h1-4,9H,5-8,14H2 |
| InChIKey | NQEYRCRYLQNBND-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.26 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |