About 2-(4-amino-2-methylbutan-2-yl)-1,1-dioxothiazinan-3-one
2-(4-amino-2-methylbutan-2-yl)-1,1-dioxothiazinan-3-one (PubChem CID 117029939) has the molecular formula C9H18N2O3S
and a molecular weight of 234.32 g/mol. Its IUPAC name is 2-(4-amino-2-methylbutan-2-yl)-1,1-dioxothiazinan-3-one.
Molecular Properties
| Compound Name | 2-(4-amino-2-methylbutan-2-yl)-1,1-dioxothiazinan-3-one |
| PubChem CID | 117029939 |
| Molecular Formula | C9H18N2O3S |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 2-(4-amino-2-methylbutan-2-yl)-1,1-dioxothiazinan-3-one |
| SMILES | CC(C)(CCN)N1C(=O)CCCS1(=O)=O |
| InChI | InChI=1S/C9H18N2O3S/c1-9(2,5-6-10)11-8(12)4-3-7-15(11,13)14/h3-7,10H2,1-2H3 |
| InChIKey | XWBUBGIACIOIAY-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(4-amino-2-methylbutan-2-yl)-1,1-dioxothiazinan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-amino-2-methylbutan-2-yl)-1,1-dioxothiazinan-3-one?
The IUPAC name of 2-(4-amino-2-methylbutan-2-yl)-1,1-dioxothiazinan-3-one (CID 117029939) is 2-(4-amino-2-methylbutan-2-yl)-1,1-dioxothiazinan-3-one.
What is the SMILES notation for 2-(4-amino-2-methylbutan-2-yl)-1,1-dioxothiazinan-3-one?
The canonical SMILES for 2-(4-amino-2-methylbutan-2-yl)-1,1-dioxothiazinan-3-one is CC(C)(CCN)N1C(=O)CCCS1(=O)=O.
What is the InChIKey of 2-(4-amino-2-methylbutan-2-yl)-1,1-dioxothiazinan-3-one?
The InChIKey is XWBUBGIACIOIAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2O3S/c1-9(2,5-6-10)11-8(12)4-3-7-15(11,13)14/h3-7,10H2,1-2H3.
What are the key properties of 2-(4-amino-2-methylbutan-2-yl)-1,1-dioxothiazinan-3-one?
2-(4-amino-2-methylbutan-2-yl)-1,1-dioxothiazinan-3-one has a molecular weight of 234.32 g/mol, XLogP of 0.07, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-amino-2-methylbutan-2-yl)-1,1-dioxothiazinan-3-one is sourced from PubChem (CID 117029939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).