C14H17N3 — CID 117030151
3-(2,3-dihydropyrrolo[2,3-b]quinolin-1-yl)propan-1-amine (PubChem CID 117030151) has the molecular formula C14H17N3 and a molecular weight of 227.31 g/mol. Its IUPAC name is 3-(2,3-dihydropyrrolo[2,3-b]quinolin-1-yl)propan-1-amine.
| Compound Name | 3-(2,3-dihydropyrrolo[2,3-b]quinolin-1-yl)propan-1-amine |
|---|---|
| PubChem CID | 117030151 |
| Molecular Formula | C14H17N3 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.14 |
| IUPAC Name | 3-(2,3-dihydropyrrolo[2,3-b]quinolin-1-yl)propan-1-amine |
| SMILES | NCCCN1CCc2cc3ccccc3nc21 |
| InChI | InChI=1S/C14H17N3/c15-7-3-8-17-9-6-12-10-11-4-1-2-5-13(11)16-14(12)17/h1-2,4-5,10H,3,6-9,15H2 |
| InChIKey | CJMGGRCLUYIXJA-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |