C12H15NO2S — CID 117033048
2-(1,3-benzodioxol-5-ylsulfanyl)piperidine (PubChem CID 117033048) has the molecular formula C12H15NO2S and a molecular weight of 237.32 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylsulfanyl)piperidine.
| Compound Name | 2-(1,3-benzodioxol-5-ylsulfanyl)piperidine |
|---|---|
| PubChem CID | 117033048 |
| Molecular Formula | C12H15NO2S |
| Molecular Weight | 237.32 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylsulfanyl)piperidine |
| SMILES | c1cc2c(cc1SC1CCCCN1)OCO2 |
| InChI | InChI=1S/C12H15NO2S/c1-2-6-13-12(3-1)16-9-4-5-10-11(7-9)15-8-14-10/h4-5,7,12-13H,1-3,6,8H2 |
| InChIKey | GZECUOKCDCDAOG-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.32 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |