C15H22OS — CID 117034461
4-(2,4,6-trimethylphenyl)sulfanylcyclohexan-1-ol (PubChem CID 117034461) has the molecular formula C15H22OS and a molecular weight of 250.41 g/mol. Its IUPAC name is 4-(2,4,6-trimethylphenyl)sulfanylcyclohexan-1-ol.
| Compound Name | 4-(2,4,6-trimethylphenyl)sulfanylcyclohexan-1-ol |
|---|---|
| PubChem CID | 117034461 |
| Molecular Formula | C15H22OS |
| Molecular Weight | 250.41 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 4-(2,4,6-trimethylphenyl)sulfanylcyclohexan-1-ol |
| SMILES | Cc1cc(C)c(SC2CCC(O)CC2)c(C)c1 |
| InChI | InChI=1S/C15H22OS/c1-10-8-11(2)15(12(3)9-10)17-14-6-4-13(16)5-7-14/h8-9,13-14,16H,4-7H2,1-3H3 |
| InChIKey | OLBFLOOXONONSO-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.41 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |