About 4-(2,4,6-trimethylphenyl)sulfanylcyclohexan-1-ol
4-(2,4,6-trimethylphenyl)sulfanylcyclohexan-1-ol (PubChem CID 117034461) has the molecular formula C15H22OS
and a molecular weight of 250.41 g/mol. Its IUPAC name is 4-(2,4,6-trimethylphenyl)sulfanylcyclohexan-1-ol.
Molecular Properties
| Compound Name | 4-(2,4,6-trimethylphenyl)sulfanylcyclohexan-1-ol |
| PubChem CID | 117034461 |
| Molecular Formula | C15H22OS |
| Molecular Weight | 250.41 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 4-(2,4,6-trimethylphenyl)sulfanylcyclohexan-1-ol |
| SMILES | Cc1cc(C)c(SC2CCC(O)CC2)c(C)c1 |
| InChI | InChI=1S/C15H22OS/c1-10-8-11(2)15(12(3)9-10)17-14-6-4-13(16)5-7-14/h8-9,13-14,16H,4-7H2,1-3H3 |
| InChIKey | OLBFLOOXONONSO-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.41 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(2,4,6-trimethylphenyl)sulfanylcyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,4,6-trimethylphenyl)sulfanylcyclohexan-1-ol?
The IUPAC name of 4-(2,4,6-trimethylphenyl)sulfanylcyclohexan-1-ol (CID 117034461) is 4-(2,4,6-trimethylphenyl)sulfanylcyclohexan-1-ol.
What is the SMILES notation for 4-(2,4,6-trimethylphenyl)sulfanylcyclohexan-1-ol?
The canonical SMILES for 4-(2,4,6-trimethylphenyl)sulfanylcyclohexan-1-ol is Cc1cc(C)c(SC2CCC(O)CC2)c(C)c1.
What is the InChIKey of 4-(2,4,6-trimethylphenyl)sulfanylcyclohexan-1-ol?
The InChIKey is OLBFLOOXONONSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22OS/c1-10-8-11(2)15(12(3)9-10)17-14-6-4-13(16)5-7-14/h8-9,13-14,16H,4-7H2,1-3H3.
What are the key properties of 4-(2,4,6-trimethylphenyl)sulfanylcyclohexan-1-ol?
4-(2,4,6-trimethylphenyl)sulfanylcyclohexan-1-ol has a molecular weight of 250.41 g/mol, XLogP of 4.01, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,4,6-trimethylphenyl)sulfanylcyclohexan-1-ol is sourced from PubChem (CID 117034461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).