C25H31NO2 — CID 11703557
(3R,8R,8aR)-6,6,8-triethyl-3,8a-diphenyl-2,3,7,8-tetrahydro-[1,3]oxazolo[3,2-a]pyridin-5-one (PubChem CID 11703557) has the molecular formula C25H31NO2 and a molecular weight of 377.53 g/mol. Its IUPAC name is (3R,8R,8aR)-6,6,8-triethyl-3,8a-diphenyl-2,3,7,8-tetrahydro-[1,3]oxazolo[3,2-a]pyridin-5-one.
| Compound Name | (3R,8R,8aR)-6,6,8-triethyl-3,8a-diphenyl-2,3,7,8-tetrahydro-[1,3]oxazolo[3,2-a]pyridin-5-one |
|---|---|
| PubChem CID | 11703557 |
| Molecular Formula | C25H31NO2 |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.24 |
| IUPAC Name | (3R,8R,8aR)-6,6,8-triethyl-3,8a-diphenyl-2,3,7,8-tetrahydro-[1,3]oxazolo[3,2-a]pyridin-5-one |
| SMILES | CC[C@@H]1CC(CC)(CC)C(=O)N2[C@H](c3ccccc3)CO[C@@]12c1ccccc1 |
| InChI | InChI=1S/C25H31NO2/c1-4-20-17-24(5-2,6-3)23(27)26-22(19-13-9-7-10-14-19)18-28-25(20,26)21-15-11-8-12-16-21/h7-16,20,22H,4-6,17-18H2,1-3H3/t20-,22+,25-/m1/s1 |
| InChIKey | PTOUMTWECXHIFT-JLRUASKGSA-N |
| XLogP | 5.68 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |