C9H9Cl2NS — CID 117035851
1-(3,4-dichlorophenyl)sulfanylcyclopropan-1-amine (PubChem CID 117035851) has the molecular formula C9H9Cl2NS and a molecular weight of 234.15 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)sulfanylcyclopropan-1-amine.
| Compound Name | 1-(3,4-dichlorophenyl)sulfanylcyclopropan-1-amine |
|---|---|
| PubChem CID | 117035851 |
| Molecular Formula | C9H9Cl2NS |
| Molecular Weight | 234.15 g/mol |
| Exact Mass | 232.98 |
| IUPAC Name | 1-(3,4-dichlorophenyl)sulfanylcyclopropan-1-amine |
| SMILES | NC1(Sc2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C9H9Cl2NS/c10-7-2-1-6(5-8(7)11)13-9(12)3-4-9/h1-2,5H,3-4,12H2 |
| InChIKey | ZPDHVZJGZBABKQ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.15 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|