C14H15ClF3N — CID 117047105
1,1,1-trifluoro-4-naphthalen-2-ylbutan-2-amine;hydrochloride (PubChem CID 117047105) has the molecular formula C14H15ClF3N and a molecular weight of 289.73 g/mol. Its IUPAC name is 1,1,1-trifluoro-4-naphthalen-2-ylbutan-2-amine;hydrochloride.
| Compound Name | 1,1,1-trifluoro-4-naphthalen-2-ylbutan-2-amine;hydrochloride |
|---|---|
| PubChem CID | 117047105 |
| Molecular Formula | C14H15ClF3N |
| Molecular Weight | 289.73 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | 1,1,1-trifluoro-4-naphthalen-2-ylbutan-2-amine;hydrochloride |
| SMILES | Cl.NC(CCc1ccc2ccccc2c1)C(F)(F)F |
| InChI | InChI=1S/C14H14F3N.ClH/c15-14(16,17)13(18)8-6-10-5-7-11-3-1-2-4-12(11)9-10;/h1-5,7,9,13H,6,8,18H2;1H |
| InChIKey | YKSNCQRLDIAIJR-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.73 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |