C15H16F2 — CID 68979271
2-(5,5-difluoropentyl)naphthalene (PubChem CID 68979271) has the molecular formula C15H16F2 and a molecular weight of 234.29 g/mol. Its IUPAC name is 2-(5,5-difluoropentyl)naphthalene.
| Compound Name | 2-(5,5-difluoropentyl)naphthalene |
|---|---|
| PubChem CID | 68979271 |
| Molecular Formula | C15H16F2 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | 2-(5,5-difluoropentyl)naphthalene |
| SMILES | FC(F)CCCCc1ccc2ccccc2c1 |
| InChI | InChI=1S/C15H16F2/c16-15(17)8-4-1-5-12-9-10-13-6-2-3-7-14(13)11-12/h2-3,6-7,9-11,15H,1,4-5,8H2 |
| InChIKey | QWKZXGSJJQIGSG-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|