C10H7ClOS2 — CID 117060094
4-(4-chlorophenyl)-5-methyl-1,3-dithiol-2-one (PubChem CID 117060094) has the molecular formula C10H7ClOS2 and a molecular weight of 242.75 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-5-methyl-1,3-dithiol-2-one.
| Compound Name | 4-(4-chlorophenyl)-5-methyl-1,3-dithiol-2-one |
|---|---|
| PubChem CID | 117060094 |
| Molecular Formula | C10H7ClOS2 |
| Molecular Weight | 242.75 g/mol |
| Exact Mass | 241.96 |
| IUPAC Name | 4-(4-chlorophenyl)-5-methyl-1,3-dithiol-2-one |
| SMILES | Cc1sc(=O)sc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C10H7ClOS2/c1-6-9(14-10(12)13-6)7-2-4-8(11)5-3-7/h2-5H,1H3 |
| InChIKey | GVGBBHRAYFAXNT-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.75 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |