C4H7NNa2O5S — CID 117062093
CID 117062093 (PubChem CID 117062093) has the molecular formula C4H7NNa2O5S and a molecular weight of 227.15 g/mol.
| Compound Name | CID 117062093 |
|---|---|
| PubChem CID | 117062093 |
| Molecular Formula | C4H7NNa2O5S |
| Molecular Weight | 227.15 g/mol |
| Exact Mass | 226.98 |
| IUPAC Name | — |
| SMILES | CCS(=O)(=O)NC(=O)C(=O)O.[Na].[Na] |
| InChI | InChI=1S/C4H7NO5S.2Na/c1-2-11(9,10)5-3(6)4(7)8;;/h2H2,1H3,(H,5,6)(H,7,8);; |
| InChIKey | ZKHMDIGDGJPZMX-UHFFFAOYSA-N |
| XLogP | -2.22 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.15 |
| LogP ≤ 5 | -2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|