C14H26N2O8S2 — CID 126483399
(E)-2,3-bis[(2S)-2-(ethylsulfonylamino)propyl]but-2-enedioic acid (PubChem CID 126483399) has the molecular formula C14H26N2O8S2 and a molecular weight of 414.50 g/mol. Its IUPAC name is (E)-2,3-bis[(2S)-2-(ethylsulfonylamino)propyl]but-2-enedioic acid.
| Compound Name | (E)-2,3-bis[(2S)-2-(ethylsulfonylamino)propyl]but-2-enedioic acid |
|---|---|
| PubChem CID | 126483399 |
| Molecular Formula | C14H26N2O8S2 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | (E)-2,3-bis[(2S)-2-(ethylsulfonylamino)propyl]but-2-enedioic acid |
| SMILES | CCS(=O)(=O)N[C@@H](C)C/C(C(=O)O)=C(/C[C@H](C)NS(=O)(=O)CC)C(=O)O |
| InChI | InChI=1S/C14H26N2O8S2/c1-5-25(21,22)15-9(3)7-11(13(17)18)12(14(19)20)8-10(4)16-26(23,24)6-2/h9-10,15-16H,5-8H2,1-4H3,(H,17,18)(H,19,20)/b12-11+/t9-,10-/m0/s1 |
| InChIKey | WIAUVUUJUGRIMC-UIMDQTJZSA-N |
| XLogP | -0.11 |
| TPSA | 166.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|