C18H30N2O6 — CID 126483204
(E)-2,3-bis[(2S)-2-(2-methylpropanoylamino)propyl]but-2-enedioic acid (PubChem CID 126483204) has the molecular formula C18H30N2O6 and a molecular weight of 370.45 g/mol. Its IUPAC name is (E)-2,3-bis[(2S)-2-(2-methylpropanoylamino)propyl]but-2-enedioic acid.
| Compound Name | (E)-2,3-bis[(2S)-2-(2-methylpropanoylamino)propyl]but-2-enedioic acid |
|---|---|
| PubChem CID | 126483204 |
| Molecular Formula | C18H30N2O6 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | (E)-2,3-bis[(2S)-2-(2-methylpropanoylamino)propyl]but-2-enedioic acid |
| SMILES | CC(C)C(=O)N[C@@H](C)C/C(C(=O)O)=C(/C[C@H](C)NC(=O)C(C)C)C(=O)O |
| InChI | InChI=1S/C18H30N2O6/c1-9(2)15(21)19-11(5)7-13(17(23)24)14(18(25)26)8-12(6)20-16(22)10(3)4/h9-12H,7-8H2,1-6H3,(H,19,21)(H,20,22)(H,23,24)(H,25,26)/b14-13+/t11-,12-/m0/s1 |
| InChIKey | JKOZBFNBQVSIKY-XILWIIGUSA-N |
| XLogP | 1.55 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|