C8H16N2OS — CID 62093157
N-(4-amino-4-sulfanylidenebutan-2-yl)-2-methylpropanamide (PubChem CID 62093157) has the molecular formula C8H16N2OS and a molecular weight of 188.30 g/mol. Its IUPAC name is N-(4-amino-4-sulfanylidenebutan-2-yl)-2-methylpropanamide.
| Compound Name | N-(4-amino-4-sulfanylidenebutan-2-yl)-2-methylpropanamide |
|---|---|
| PubChem CID | 62093157 |
| Molecular Formula | C8H16N2OS |
| Molecular Weight | 188.30 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | N-(4-amino-4-sulfanylidenebutan-2-yl)-2-methylpropanamide |
| SMILES | CC(CC(N)=S)NC(=O)C(C)C |
| InChI | InChI=1S/C8H16N2OS/c1-5(2)8(11)10-6(3)4-7(9)12/h5-6H,4H2,1-3H3,(H2,9,12)(H,10,11) |
| InChIKey | YAZDWUNDAHAWBM-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.30 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|