C7H15FNO2PS2 — CID 117063359
2-[ethoxy(methyl)phosphinothioyl]sulfanyl-2-fluoro-N,N-dimethylacetamide (PubChem CID 117063359) has the molecular formula C7H15FNO2PS2 and a molecular weight of 259.31 g/mol. Its IUPAC name is 2-[ethoxy(methyl)phosphinothioyl]sulfanyl-2-fluoro-N,N-dimethylacetamide.
| Compound Name | 2-[ethoxy(methyl)phosphinothioyl]sulfanyl-2-fluoro-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 117063359 |
| Molecular Formula | C7H15FNO2PS2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.03 |
| IUPAC Name | 2-[ethoxy(methyl)phosphinothioyl]sulfanyl-2-fluoro-N,N-dimethylacetamide |
| SMILES | CCOP(C)(=S)SC(F)C(=O)N(C)C |
| InChI | InChI=1S/C7H15FNO2PS2/c1-5-11-12(4,13)14-6(8)7(10)9(2)3/h6H,5H2,1-4H3 |
| InChIKey | RBUGQDSMOJCPPA-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|