C32H34Cl3NO2 — CID 117066965
N-[(4-butoxyphenyl)methyl]-1,3-diphenylpropan-2-amine;2,4,5-trichlorophenol (PubChem CID 117066965) has the molecular formula C32H34Cl3NO2 and a molecular weight of 570.99 g/mol. Its IUPAC name is N-[(4-butoxyphenyl)methyl]-1,3-diphenylpropan-2-amine;2,4,5-trichlorophenol.
| Compound Name | N-[(4-butoxyphenyl)methyl]-1,3-diphenylpropan-2-amine;2,4,5-trichlorophenol |
|---|---|
| PubChem CID | 117066965 |
| Molecular Formula | C32H34Cl3NO2 |
| Molecular Weight | 570.99 g/mol |
| Exact Mass | 569.17 |
| IUPAC Name | N-[(4-butoxyphenyl)methyl]-1,3-diphenylpropan-2-amine;2,4,5-trichlorophenol |
| SMILES | CCCCOc1ccc(CNC(Cc2ccccc2)Cc2ccccc2)cc1.Oc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C26H31NO.C6H3Cl3O/c1-2-3-18-28-26-16-14-24(15-17-26)21-27-25(19-22-10-6-4-7-11-22)20-23-12-8-5-9-13-23;7-3-1-5(9)6(10)2-4(3)8/h4-17,25,27H,2-3,18-21H2,1H3;1-2,10H |
| InChIKey | JSRMDZYHNBTMKO-UHFFFAOYSA-N |
| XLogP | 9.16 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.99 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|