C23H34ClNS2 — CID 117068980
2-[(4-hexylsulfanylphenyl)-phenylmethyl]sulfanyl-N,N-dimethylethanamine;hydrochloride (PubChem CID 117068980) has the molecular formula C23H34ClNS2 and a molecular weight of 424.12 g/mol. Its IUPAC name is 2-[(4-hexylsulfanylphenyl)-phenylmethyl]sulfanyl-N,N-dimethylethanamine;hydrochloride.
| Compound Name | 2-[(4-hexylsulfanylphenyl)-phenylmethyl]sulfanyl-N,N-dimethylethanamine;hydrochloride |
|---|---|
| PubChem CID | 117068980 |
| Molecular Formula | C23H34ClNS2 |
| Molecular Weight | 424.12 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | 2-[(4-hexylsulfanylphenyl)-phenylmethyl]sulfanyl-N,N-dimethylethanamine;hydrochloride |
| SMILES | CCCCCCSc1ccc(C(SCCN(C)C)c2ccccc2)cc1.Cl |
| InChI | InChI=1S/C23H33NS2.ClH/c1-4-5-6-10-18-25-22-15-13-21(14-16-22)23(26-19-17-24(2)3)20-11-8-7-9-12-20;/h7-9,11-16,23H,4-6,10,17-19H2,1-3H3;1H |
| InChIKey | GJSFDGAUAWIESX-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.12 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|