C21H29NS2 — CID 76959959
2-[(S)-(4-butylsulfanylphenyl)-phenylmethyl]sulfanyl-N,N-dimethylethanamine (PubChem CID 76959959) has the molecular formula C21H29NS2 and a molecular weight of 359.60 g/mol. Its IUPAC name is 2-[(S)-(4-butylsulfanylphenyl)-phenylmethyl]sulfanyl-N,N-dimethylethanamine.
| Compound Name | 2-[(S)-(4-butylsulfanylphenyl)-phenylmethyl]sulfanyl-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 76959959 |
| Molecular Formula | C21H29NS2 |
| Molecular Weight | 359.60 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | 2-[(S)-(4-butylsulfanylphenyl)-phenylmethyl]sulfanyl-N,N-dimethylethanamine |
| SMILES | CCCCSc1ccc([C@@H](SCCN(C)C)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H29NS2/c1-4-5-16-23-20-13-11-19(12-14-20)21(24-17-15-22(2)3)18-9-7-6-8-10-18/h6-14,21H,4-5,15-17H2,1-3H3/t21-/m0/s1 |
| InChIKey | IZLPZXSZLLELBJ-NRFANRHFSA-N |
| XLogP | 5.96 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.60 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|