C12H18O — CID 117069606
(10S)-tetracyclo[6.2.1.12,5.01,6]dodecan-10-ol (PubChem CID 117069606) has the molecular formula C12H18O and a molecular weight of 178.27 g/mol. Its IUPAC name is (10S)-tetracyclo[6.2.1.12,5.01,6]dodecan-10-ol.
| Compound Name | (10S)-tetracyclo[6.2.1.12,5.01,6]dodecan-10-ol |
|---|---|
| PubChem CID | 117069606 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.27 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | (10S)-tetracyclo[6.2.1.12,5.01,6]dodecan-10-ol |
| SMILES | O[C@H]1CC2CC3C4CCC(C4)C31C2 |
| InChI | InChI=1S/C12H18O/c13-11-4-7-3-10-8-1-2-9(5-8)12(10,11)6-7/h7-11,13H,1-6H2/t7?,8?,9?,10?,11-,12?/m0/s1 |
| InChIKey | PROFNVHSYXPIAO-FMBFNZMWSA-N |
| XLogP | 2.19 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.27 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |