C13H20O5S — CID 117070474
methyl 1-ethenyl-5-methylsulfonyloxybicyclo[2.2.2]octane-2-carboxylate (PubChem CID 117070474) has the molecular formula C13H20O5S and a molecular weight of 288.37 g/mol. Its IUPAC name is methyl 1-ethenyl-5-methylsulfonyloxybicyclo[2.2.2]octane-2-carboxylate.
| Compound Name | methyl 1-ethenyl-5-methylsulfonyloxybicyclo[2.2.2]octane-2-carboxylate |
|---|---|
| PubChem CID | 117070474 |
| Molecular Formula | C13H20O5S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | methyl 1-ethenyl-5-methylsulfonyloxybicyclo[2.2.2]octane-2-carboxylate |
| SMILES | C=CC12CCC(CC1C(=O)OC)C(OS(C)(=O)=O)C2 |
| InChI | InChI=1S/C13H20O5S/c1-4-13-6-5-9(7-10(13)12(14)17-2)11(8-13)18-19(3,15)16/h4,9-11H,1,5-8H2,2-3H3 |
| InChIKey | UTWSMYNQJAOHDG-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|