C14H20Cl4 — CID 117070544
2,3,6,7-tetrakis(chloromethyl)-1,2,3,4,5,6,7,8-octahydronaphthalene (PubChem CID 117070544) has the molecular formula C14H20Cl4 and a molecular weight of 330.13 g/mol. Its IUPAC name is 2,3,6,7-tetrakis(chloromethyl)-1,2,3,4,5,6,7,8-octahydronaphthalene.
| Compound Name | 2,3,6,7-tetrakis(chloromethyl)-1,2,3,4,5,6,7,8-octahydronaphthalene |
|---|---|
| PubChem CID | 117070544 |
| Molecular Formula | C14H20Cl4 |
| Molecular Weight | 330.13 g/mol |
| Exact Mass | 328.03 |
| IUPAC Name | 2,3,6,7-tetrakis(chloromethyl)-1,2,3,4,5,6,7,8-octahydronaphthalene |
| SMILES | ClCC1CC2=C(CC1CCl)CC(CCl)C(CCl)C2 |
| InChI | InChI=1S/C14H20Cl4/c15-5-11-1-9-2-13(7-17)14(8-18)4-10(9)3-12(11)6-16/h11-14H,1-8H2 |
| InChIKey | ZRGCPFSQIGVOOK-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.13 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|