C25H26ClF7N8 — CID 11707070
6-[(2R)-4-(3-chloro-2-pyridinyl)-2-methylpiperazin-1-yl]-2-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-4-N-propyl-1,3,5-triazine-2,4-diamine (PubChem CID 11707070) has the molecular formula C25H26ClF7N8 and a molecular weight of 606.98 g/mol. Its IUPAC name is 6-[(2R)-4-(3-chloro-2-pyridinyl)-2-methylpiperazin-1-yl]-2-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-4-N-propyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[(2R)-4-(3-chloro-2-pyridinyl)-2-methylpiperazin-1-yl]-2-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-4-N-propyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 11707070 |
| Molecular Formula | C25H26ClF7N8 |
| Molecular Weight | 606.98 g/mol |
| Exact Mass | 606.19 |
| IUPAC Name | 6-[(2R)-4-(3-chloro-2-pyridinyl)-2-methylpiperazin-1-yl]-2-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-4-N-propyl-1,3,5-triazine-2,4-diamine |
| SMILES | CCCNc1nc(Nc2ccc(C(F)(C(F)(F)F)C(F)(F)F)cc2)nc(N2CCN(c3ncccc3Cl)C[C@H]2C)n1 |
| InChI | InChI=1S/C25H26ClF7N8/c1-3-10-35-20-37-21(36-17-8-6-16(7-9-17)23(27,24(28,29)30)25(31,32)33)39-22(38-20)41-13-12-40(14-15(41)2)19-18(26)5-4-11-34-19/h4-9,11,15H,3,10,12-14H2,1-2H3,(H2,35,36,37,38,39)/t15-/m1/s1 |
| InChIKey | JQVGSNINXRKYOO-OAHLLOKOSA-N |
| XLogP | 6.49 |
| TPSA | 82.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.98 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |