C20H22N6O2S2 — CID 117076406
2-methylsulfanyl-4-[[2-(4-morpholin-4-ylanilino)-4-pyridinyl]amino]-1,3-thiazole-5-carboxamide (PubChem CID 117076406) has the molecular formula C20H22N6O2S2 and a molecular weight of 442.57 g/mol. Its IUPAC name is 2-methylsulfanyl-4-[[2-(4-morpholin-4-ylanilino)-4-pyridinyl]amino]-1,3-thiazole-5-carboxamide.
| Compound Name | 2-methylsulfanyl-4-[[2-(4-morpholin-4-ylanilino)-4-pyridinyl]amino]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 117076406 |
| Molecular Formula | C20H22N6O2S2 |
| Molecular Weight | 442.57 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | 2-methylsulfanyl-4-[[2-(4-morpholin-4-ylanilino)-4-pyridinyl]amino]-1,3-thiazole-5-carboxamide |
| SMILES | CSc1nc(Nc2ccnc(Nc3ccc(N4CCOCC4)cc3)c2)c(C(N)=O)s1 |
| InChI | InChI=1S/C20H22N6O2S2/c1-29-20-25-19(17(30-20)18(21)27)24-14-6-7-22-16(12-14)23-13-2-4-15(5-3-13)26-8-10-28-11-9-26/h2-7,12H,8-11H2,1H3,(H2,21,27)(H2,22,23,24) |
| InChIKey | PNICHUXQZCFIRG-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 105.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.57 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|